C9H19N3O2 — CID 91306417
1-[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-4-methoxybutan-1-one (PubChem CID 91306417) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 91306417 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)N1C[C@@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C9H19N3O2/c1-14-4-2-3-9(13)12-5-7(10)8(11)6-12/h7-8H,2-6,10-11H2,1H3/t7-,8-/m1/s1 |
| InChIKey | OTSCIGZBINIQIM-HTQZYQBOSA-N |
| XLogP | -1.09 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|