C17H19ClN2O4S — CID 169179944
tert-butyl 4-[(4-chlorophenyl)carbamothioyl]-3-hydroxy-5-oxo-2,6-dihydropyridine-1-carboxylate (PubChem CID 169179944) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is tert-butyl 4-[(4-chlorophenyl)carbamothioyl]-3-hydroxy-5-oxo-2,6-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-chlorophenyl)carbamothioyl]-3-hydroxy-5-oxo-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 169179944 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | tert-butyl 4-[(4-chlorophenyl)carbamothioyl]-3-hydroxy-5-oxo-2,6-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C(C(=S)Nc2ccc(Cl)cc2)=C(O)C1 |
| InChI | InChI=1S/C17H19ClN2O4S/c1-17(2,3)24-16(23)20-8-12(21)14(13(22)9-20)15(25)19-11-6-4-10(18)5-7-11/h4-7,21H,8-9H2,1-3H3,(H,19,25) |
| InChIKey | AXLPWUGKMRNGOT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|