About tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate
tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate (PubChem CID 69346526) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate.
Analyze tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate?
The IUPAC name of tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate (CID 69346526) is tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate.
What is the SMILES notation for tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate?
The canonical SMILES for tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate is CC(C)(C)OC(=O)N1CC(=O)c2cocc2C1.
What is the InChIKey of tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate?
The InChIKey is OCEOUBXXWHEKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-12(2,3)17-11(15)13-4-8-6-16-7-9(8)10(14)5-13/h6-7H,4-5H2,1-3H3.
What are the key properties of tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate?
tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate has a molecular weight of 237.25 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-oxo-4,6-dihydrofuro[3,4-c]pyridine-5-carboxylate is sourced from PubChem (CID 69346526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).