C18H24ClN3O3 — CID 102108758
tert-butyl (3S,6R)-2-[(4-chlorophenyl)carbamoyl]-3,6-dimethyl-3,6-dihydropyridazine-1-carboxylate (PubChem CID 102108758) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is tert-butyl (3S,6R)-2-[(4-chlorophenyl)carbamoyl]-3,6-dimethyl-3,6-dihydropyridazine-1-carboxylate.
| Compound Name | tert-butyl (3S,6R)-2-[(4-chlorophenyl)carbamoyl]-3,6-dimethyl-3,6-dihydropyridazine-1-carboxylate |
|---|---|
| PubChem CID | 102108758 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | tert-butyl (3S,6R)-2-[(4-chlorophenyl)carbamoyl]-3,6-dimethyl-3,6-dihydropyridazine-1-carboxylate |
| SMILES | C[C@@H]1C=C[C@H](C)N(C(=O)Nc2ccc(Cl)cc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24ClN3O3/c1-12-6-7-13(2)22(17(24)25-18(3,4)5)21(12)16(23)20-15-10-8-14(19)9-11-15/h6-13H,1-5H3,(H,20,23)/t12-,13+/m0/s1 |
| InChIKey | TXUYYXHPHDDLLX-QWHCGFSZSA-N |
| XLogP | 4.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|