C24H32ClN3O4 — CID 132539762
tert-butyl (3S,7aR)-1-[(4-chlorophenyl)carbamoyl]-3-cyclohexyl-3,6,7,7a-tetrahydrofuro[3,2-c]pyridazine-2-carboxylate (PubChem CID 132539762) has the molecular formula C24H32ClN3O4 and a molecular weight of 461.99 g/mol. Its IUPAC name is tert-butyl (3S,7aR)-1-[(4-chlorophenyl)carbamoyl]-3-cyclohexyl-3,6,7,7a-tetrahydrofuro[3,2-c]pyridazine-2-carboxylate.
| Compound Name | tert-butyl (3S,7aR)-1-[(4-chlorophenyl)carbamoyl]-3-cyclohexyl-3,6,7,7a-tetrahydrofuro[3,2-c]pyridazine-2-carboxylate |
|---|---|
| PubChem CID | 132539762 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | tert-butyl (3S,7aR)-1-[(4-chlorophenyl)carbamoyl]-3-cyclohexyl-3,6,7,7a-tetrahydrofuro[3,2-c]pyridazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C2CCCCC2)C=C2OCC[C@H]2N1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN3O4/c1-24(2,3)32-23(30)28-20(16-7-5-4-6-8-16)15-21-19(13-14-31-21)27(28)22(29)26-18-11-9-17(25)10-12-18/h9-12,15-16,19-20H,4-8,13-14H2,1-3H3,(H,26,29)/t19-,20-/m1/s1 |
| InChIKey | AQCXAYYUUSFISA-WOJBJXKFSA-N |
| XLogP | 5.96 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |