C24H26BrClN4O4S — CID 170554394
tert-butyl 4-[(3-bromo-4-pyridinyl)methylamino]-5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-6-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 170554394) has the molecular formula C24H26BrClN4O4S and a molecular weight of 581.92 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromo-4-pyridinyl)methylamino]-5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-6-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-bromo-4-pyridinyl)methylamino]-5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 170554394 |
| Molecular Formula | C24H26BrClN4O4S |
| Molecular Weight | 581.92 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | tert-butyl 4-[(3-bromo-4-pyridinyl)methylamino]-5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | Cc1c(Cl)cccc1SNC(=O)C1=C(NCc2ccncc2Br)CCN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C24H26BrClN4O4S/c1-14-17(26)6-5-7-19(14)35-29-21(31)20-18(28-12-15-8-10-27-13-16(15)25)9-11-30(22(20)32)23(33)34-24(2,3)4/h5-8,10,13,28H,9,11-12H2,1-4H3,(H,29,31) |
| InChIKey | JMTLLTBJLDRVSV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|