C18H21ClN2O5S — CID 163208920
tert-butyl 5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 163208920) has the molecular formula C18H21ClN2O5S and a molecular weight of 412.90 g/mol. Its IUPAC name is tert-butyl 5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 163208920 |
| Molecular Formula | C18H21ClN2O5S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | tert-butyl 5-[(3-chloro-2-methylphenyl)sulfanylcarbamoyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | Cc1c(Cl)cccc1SNC(=O)C1=C(O)CCN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H21ClN2O5S/c1-10-11(19)6-5-7-13(10)27-20-15(23)14-12(22)8-9-21(16(14)24)17(25)26-18(2,3)4/h5-7,22H,8-9H2,1-4H3,(H,20,23) |
| InChIKey | VOYNRIUWBHZIRL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|