C21H19ClN2O4S — CID 10972059
tert-butyl 5-chloro-7-(1,3-dioxoisoindol-2-yl)sulfanyl-2,3-dihydroindole-1-carboxylate (PubChem CID 10972059) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is tert-butyl 5-chloro-7-(1,3-dioxoisoindol-2-yl)sulfanyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-chloro-7-(1,3-dioxoisoindol-2-yl)sulfanyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10972059 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | tert-butyl 5-chloro-7-(1,3-dioxoisoindol-2-yl)sulfanyl-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(Cl)cc(SN3C(=O)c4ccccc4C3=O)c21 |
| InChI | InChI=1S/C21H19ClN2O4S/c1-21(2,3)28-20(27)23-9-8-12-10-13(22)11-16(17(12)23)29-24-18(25)14-6-4-5-7-15(14)19(24)26/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | ZUGNMHHDPGAXRR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|