C14H18BrNO2 — CID 153360716
tert-butyl 5-bromo-7-methyl-2,3-dihydroindole-1-carboxylate (PubChem CID 153360716) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is tert-butyl 5-bromo-7-methyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-bromo-7-methyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 153360716 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | tert-butyl 5-bromo-7-methyl-2,3-dihydroindole-1-carboxylate |
| SMILES | Cc1cc(Br)cc2c1N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C14H18BrNO2/c1-9-7-11(15)8-10-5-6-16(12(9)10)13(17)18-14(2,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | GLZMGYDAAVPDIR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |