C14H17ClN2O3 — CID 86690274
tert-butyl 2-chloro-4-methyl-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate (PubChem CID 86690274) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is tert-butyl 2-chloro-4-methyl-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2-chloro-4-methyl-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 86690274 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | tert-butyl 2-chloro-4-methyl-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
| SMILES | Cc1cc(Cl)nc2c1C(=O)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C14H17ClN2O3/c1-8-7-10(15)16-9-5-6-17(12(18)11(8)9)13(19)20-14(2,3)4/h7H,5-6H2,1-4H3 |
| InChIKey | AQDAONWZFXSJNA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|