C16H20BrN3O2 — CID 122540217
tert-butyl 12-bromo-11-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylate (PubChem CID 122540217) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is tert-butyl 12-bromo-11-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylate.
| Compound Name | tert-butyl 12-bromo-11-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 122540217 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | tert-butyl 12-bromo-11-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylate |
| SMILES | Cc1cc2nc3c(n2cc1Br)N(C(=O)OC(C)(C)C)CCC3 |
| InChI | InChI=1S/C16H20BrN3O2/c1-10-8-13-18-12-6-5-7-19(15(21)22-16(2,3)4)14(12)20(13)9-11(10)17/h8-9H,5-7H2,1-4H3 |
| InChIKey | QGYGBDSAJHKAAY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |