C14H19ClN2O4 — CID 144518623
tert-butyl 2-chloro-5,5-dihydroxy-4-methyl-7,8-dihydro-1,6-naphthyridine-6-carboxylate (PubChem CID 144518623) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is tert-butyl 2-chloro-5,5-dihydroxy-4-methyl-7,8-dihydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2-chloro-5,5-dihydroxy-4-methyl-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 144518623 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | tert-butyl 2-chloro-5,5-dihydroxy-4-methyl-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
| SMILES | Cc1cc(Cl)nc2c1C(O)(O)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C14H19ClN2O4/c1-8-7-10(15)16-9-5-6-17(14(19,20)11(8)9)12(18)21-13(2,3)4/h7,19-20H,5-6H2,1-4H3 |
| InChIKey | QVRWHLSROPEXDB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|