C20H26ClN3O5 — CID 177188718
tert-butyl (3E)-3-[[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylidene]-2-oxopyrrolidine-1-carboxylate (PubChem CID 177188718) has the molecular formula C20H26ClN3O5 and a molecular weight of 423.90 g/mol. Its IUPAC name is tert-butyl (3E)-3-[[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylidene]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-[[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylidene]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177188718 |
| Molecular Formula | C20H26ClN3O5 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | tert-butyl (3E)-3-[[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylidene]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(Cl)ccc1/C=C1\CCN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H26ClN3O5/c1-19(2,3)28-17(26)23-15-12(7-8-14(21)22-15)11-13-9-10-24(16(13)25)18(27)29-20(4,5)6/h7-8,11H,9-10H2,1-6H3,(H,22,23,26)/b13-11+ |
| InChIKey | GEQNZEOVJRNOAM-ACCUITESSA-N |
| XLogP | 4.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|