C25H28ClN3O5S — CID 153469271
ditert-butyl (15S)-5-chloro-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaene-14,17-dicarboxylate (PubChem CID 153469271) has the molecular formula C25H28ClN3O5S and a molecular weight of 518.04 g/mol. Its IUPAC name is ditert-butyl (15S)-5-chloro-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaene-14,17-dicarboxylate.
| Compound Name | ditert-butyl (15S)-5-chloro-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaene-14,17-dicarboxylate |
|---|---|
| PubChem CID | 153469271 |
| Molecular Formula | C25H28ClN3O5S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | ditert-butyl (15S)-5-chloro-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaene-14,17-dicarboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)c2c(sc3ccc4nc(Cl)ccc4c23)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28ClN3O5S/c1-13-12-28(22(31)33-24(2,3)4)19-18-14-8-11-17(26)27-15(14)9-10-16(18)35-20(19)21(30)29(13)23(32)34-25(5,6)7/h8-11,13H,12H2,1-7H3/t13-/m0/s1 |
| InChIKey | HKDWTXUAODBCMJ-ZDUSSCGKSA-N |
| XLogP | 6.62 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|