C21H23ClN2O3 — CID 164562959
tert-butyl 2-chloro-5-oxo-7-(2-phenylethyl)-7,8-dihydro-1,6-naphthyridine-6-carboxylate (PubChem CID 164562959) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is tert-butyl 2-chloro-5-oxo-7-(2-phenylethyl)-7,8-dihydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2-chloro-5-oxo-7-(2-phenylethyl)-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 164562959 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl 2-chloro-5-oxo-7-(2-phenylethyl)-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)c2ccc(Cl)nc2CC1CCc1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-21(2,3)27-20(26)24-15(10-9-14-7-5-4-6-8-14)13-17-16(19(24)25)11-12-18(22)23-17/h4-8,11-12,15H,9-10,13H2,1-3H3 |
| InChIKey | MFMPWJIWFZSHHR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|