C22H25ClN2O3 — CID 134846448
tert-butyl (2R)-4-benzyl-2-(chloromethyl)-5-oxo-2,3-dihydro-1,4-benzodiazepine-1-carboxylate (PubChem CID 134846448) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is tert-butyl (2R)-4-benzyl-2-(chloromethyl)-5-oxo-2,3-dihydro-1,4-benzodiazepine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-benzyl-2-(chloromethyl)-5-oxo-2,3-dihydro-1,4-benzodiazepine-1-carboxylate |
|---|---|
| PubChem CID | 134846448 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | tert-butyl (2R)-4-benzyl-2-(chloromethyl)-5-oxo-2,3-dihydro-1,4-benzodiazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2C(=O)N(Cc2ccccc2)C[C@@H]1CCl |
| InChI | InChI=1S/C22H25ClN2O3/c1-22(2,3)28-21(27)25-17(13-23)15-24(14-16-9-5-4-6-10-16)20(26)18-11-7-8-12-19(18)25/h4-12,17H,13-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | VIDXWONTWKZIAV-KRWDZBQOSA-N |
| XLogP | 4.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|