C23H30Cl2N4O4 — CID 159922696
tert-butyl 7-chloro-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate;tert-butyl N-(6-chloro-2-pyridinyl)carbamate (PubChem CID 159922696) has the molecular formula C23H30Cl2N4O4 and a molecular weight of 497.42 g/mol. Its IUPAC name is tert-butyl 7-chloro-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate;tert-butyl N-(6-chloro-2-pyridinyl)carbamate.
| Compound Name | tert-butyl 7-chloro-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate;tert-butyl N-(6-chloro-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 159922696 |
| Molecular Formula | C23H30Cl2N4O4 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | tert-butyl 7-chloro-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate;tert-butyl N-(6-chloro-2-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(Cl)nc21.CC(C)(C)OC(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C13H17ClN2O2.C10H13ClN2O2/c1-13(2,3)18-12(17)16-8-4-5-9-6-7-10(14)15-11(9)16;1-10(2,3)15-9(14)13-8-6-4-5-7(11)12-8/h6-7H,4-5,8H2,1-3H3;4-6H,1-3H3,(H,12,13,14) |
| InChIKey | NYPOMVZQBSNGKS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|