C17H22ClN3O3 — CID 129229667
tert-butyl (1R,3S,4S)-3-[(6-chloro-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 129229667) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[(6-chloro-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[(6-chloro-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 129229667 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[(6-chloro-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-17(2,3)24-16(23)21-11-8-7-10(9-11)14(21)15(22)20-13-6-4-5-12(18)19-13/h4-6,10-11,14H,7-9H2,1-3H3,(H,19,20,22)/t10-,11+,14-/m0/s1 |
| InChIKey | DSFRWVRIHIORGT-WDMOLILDSA-N |
| XLogP | 3.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|