C15H19ClN2O3 — CID 67112342
tert-butyl 4-(2-chlorophenyl)-3-oxopiperazine-1-carboxylate (PubChem CID 67112342) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is tert-butyl 4-(2-chlorophenyl)-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-chlorophenyl)-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 67112342 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | tert-butyl 4-(2-chlorophenyl)-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2Cl)C(=O)C1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-15(2,3)21-14(20)17-8-9-18(13(19)10-17)12-7-5-4-6-11(12)16/h4-7H,8-10H2,1-3H3 |
| InChIKey | IGTVFCUBLJMFPV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |