C17H21ClN6O3 — CID 58945845
tert-butyl 4-[1-(2-chloro-3-pyridinyl)-5-methyltriazol-4-yl]-3-oxopiperazine-1-carboxylate (PubChem CID 58945845) has the molecular formula C17H21ClN6O3 and a molecular weight of 392.85 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-chloro-3-pyridinyl)-5-methyltriazol-4-yl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-chloro-3-pyridinyl)-5-methyltriazol-4-yl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58945845 |
| Molecular Formula | C17H21ClN6O3 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | tert-butyl 4-[1-(2-chloro-3-pyridinyl)-5-methyltriazol-4-yl]-3-oxopiperazine-1-carboxylate |
| SMILES | Cc1c(N2CCN(C(=O)OC(C)(C)C)CC2=O)nnn1-c1cccnc1Cl |
| InChI | InChI=1S/C17H21ClN6O3/c1-11-15(20-21-24(11)12-6-5-7-19-14(12)18)23-9-8-22(10-13(23)25)16(26)27-17(2,3)4/h5-7H,8-10H2,1-4H3 |
| InChIKey | HIOHZLQJIHVFNT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|