C22H26N2O5 — CID 18691017
tert-butyl 4-[2-[2-(hydroxymethyl)phenoxy]phenyl]-3-oxopiperazine-1-carboxylate (PubChem CID 18691017) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(hydroxymethyl)phenoxy]phenyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(hydroxymethyl)phenoxy]phenyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 18691017 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl 4-[2-[2-(hydroxymethyl)phenoxy]phenyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2Oc2ccccc2CO)C(=O)C1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2,3)29-21(27)23-12-13-24(20(26)14-23)17-9-5-7-11-19(17)28-18-10-6-4-8-16(18)15-25/h4-11,25H,12-15H2,1-3H3 |
| InChIKey | MRBIFHQPJNEOGL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |