C20H22N4OS — CID 118606736
4,4-dimethyl-6-oxo-N-phenyl-2-(pyrimidin-4-ylmethylamino)cyclohexene-1-carbothioamide (PubChem CID 118606736) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 4,4-dimethyl-6-oxo-N-phenyl-2-(pyrimidin-4-ylmethylamino)cyclohexene-1-carbothioamide.
| Compound Name | 4,4-dimethyl-6-oxo-N-phenyl-2-(pyrimidin-4-ylmethylamino)cyclohexene-1-carbothioamide |
|---|---|
| PubChem CID | 118606736 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4,4-dimethyl-6-oxo-N-phenyl-2-(pyrimidin-4-ylmethylamino)cyclohexene-1-carbothioamide |
| SMILES | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)=C(NCc2ccncn2)C1 |
| InChI | InChI=1S/C20H22N4OS/c1-20(2)10-16(22-12-15-8-9-21-13-23-15)18(17(25)11-20)19(26)24-14-6-4-3-5-7-14/h3-9,13,22H,10-12H2,1-2H3,(H,24,26) |
| InChIKey | VFOMOARZGSDDGS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|