C23H25FN2OS — CID 7241045
N-(4-fluorophenyl)-4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexane-1-carbothioamide (PubChem CID 7241045) has the molecular formula C23H25FN2OS and a molecular weight of 396.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexane-1-carbothioamide.
| Compound Name | N-(4-fluorophenyl)-4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 7241045 |
| Molecular Formula | C23H25FN2OS |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(4-fluorophenyl)-4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexane-1-carbothioamide |
| SMILES | CC1(C)CC(=O)C(C(=S)Nc2ccc(F)cc2)/C(=N/CCc2ccccc2)C1 |
| InChI | InChI=1S/C23H25FN2OS/c1-23(2)14-19(25-13-12-16-6-4-3-5-7-16)21(20(27)15-23)22(28)26-18-10-8-17(24)9-11-18/h3-11,21H,12-15H2,1-2H3,(H,26,28)/b25-19+ |
| InChIKey | DNPXQJVODIYJOY-NCELDCMTSA-N |
| XLogP | 5.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|