C12H10F3NO — CID 167872368
N-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide (PubChem CID 167872368) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 167872368 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C12CC1C2 |
| InChI | InChI=1S/C12H10F3NO/c13-12(14,15)7-1-3-9(4-2-7)16-10(17)11-5-8(11)6-11/h1-4,8H,5-6H2,(H,16,17) |
| InChIKey | YWGSSYWJXGVNFI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |