C15H22FNO3 — CID 111480362
2-(2-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylpentyl)acetamide (PubChem CID 111480362) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylpentyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylpentyl)acetamide |
|---|---|
| PubChem CID | 111480362 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylpentyl)acetamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C15H22FNO3/c1-11(18)8-15(2,3)10-17-14(19)9-20-13-7-5-4-6-12(13)16/h4-7,11,18H,8-10H2,1-3H3,(H,17,19) |
| InChIKey | QGHGAXVHHATZAE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |