C15H20F2N2O3 — CID 95773573
N-(2,6-difluorophenyl)-N'-[(2S)-1-methoxyhexan-2-yl]oxamide (PubChem CID 95773573) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N'-[(2S)-1-methoxyhexan-2-yl]oxamide.
| Compound Name | N-(2,6-difluorophenyl)-N'-[(2S)-1-methoxyhexan-2-yl]oxamide |
|---|---|
| PubChem CID | 95773573 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-(2,6-difluorophenyl)-N'-[(2S)-1-methoxyhexan-2-yl]oxamide |
| SMILES | CCCC[C@@H](COC)NC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H20F2N2O3/c1-3-4-6-10(9-22-2)18-14(20)15(21)19-13-11(16)7-5-8-12(13)17/h5,7-8,10H,3-4,6,9H2,1-2H3,(H,18,20)(H,19,21)/t10-/m0/s1 |
| InChIKey | TWYLHGIDXISIEZ-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|