C29H34N4O — CID 154480999
1-[2,6-di(propan-2-yl)phenyl]-3-[2-(1H-indol-2-ylamino)-2-phenylethyl]urea (PubChem CID 154480999) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(1H-indol-2-ylamino)-2-phenylethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(1H-indol-2-ylamino)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 154480999 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(1H-indol-2-ylamino)-2-phenylethyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC(Nc1cc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O/c1-19(2)23-14-10-15-24(20(3)4)28(23)33-29(34)30-18-26(21-11-6-5-7-12-21)32-27-17-22-13-8-9-16-25(22)31-27/h5-17,19-20,26,31-32H,18H2,1-4H3,(H2,30,33,34) |
| InChIKey | MLNKGZVVYMXKLX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |