C19H29NO2 — CID 111432461
N-[2,6-di(propan-2-yl)phenyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111432461) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111432461 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CC1(O)CCCC1 |
| InChI | InChI=1S/C19H29NO2/c1-13(2)15-8-7-9-16(14(3)4)18(15)20-17(21)12-19(22)10-5-6-11-19/h7-9,13-14,22H,5-6,10-12H2,1-4H3,(H,20,21) |
| InChIKey | NIQVQPBCRQNMSL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |