C23H32N2O2 — CID 3697295
1-[2,6-di(propan-2-yl)phenyl]-3-[2-(4-ethoxyphenyl)ethyl]urea (PubChem CID 3697295) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(4-ethoxyphenyl)ethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(4-ethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 3697295 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-(4-ethoxyphenyl)ethyl]urea |
| SMILES | CCOc1ccc(CCNC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-6-27-19-12-10-18(11-13-19)14-15-24-23(26)25-22-20(16(2)3)8-7-9-21(22)17(4)5/h7-13,16-17H,6,14-15H2,1-5H3,(H2,24,25,26) |
| InChIKey | HINPIGAHBNCGMF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |