C25H32N2O2 — CID 113008347
1-benzoyl-N-[2,6-di(propan-2-yl)phenyl]piperidine-4-carboxamide (PubChem CID 113008347) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-benzoyl-N-[2,6-di(propan-2-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[2,6-di(propan-2-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008347 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-benzoyl-N-[2,6-di(propan-2-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-17(2)21-11-8-12-22(18(3)4)23(21)26-24(28)19-13-15-27(16-14-19)25(29)20-9-6-5-7-10-20/h5-12,17-19H,13-16H2,1-4H3,(H,26,28) |
| InChIKey | BZXIZJJCEZSESB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |