C27H29NO2S — CID 19419311
N-[2,6-di(propan-2-yl)phenyl]-2-(9H-xanthen-9-ylsulfanyl)acetamide (PubChem CID 19419311) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-(9H-xanthen-9-ylsulfanyl)acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-(9H-xanthen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 19419311 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-(9H-xanthen-9-ylsulfanyl)acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CSC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C27H29NO2S/c1-17(2)19-12-9-13-20(18(3)4)26(19)28-25(29)16-31-27-21-10-5-7-14-23(21)30-24-15-8-6-11-22(24)27/h5-15,17-18,27H,16H2,1-4H3,(H,28,29) |
| InChIKey | XMSQZYURVOLDHB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |