C20H26N4O3S — CID 19907874
ethyl 4-[[2-(furan-3-ylmethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate (PubChem CID 19907874) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethyl 4-[[2-(furan-3-ylmethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(furan-3-ylmethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19907874 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | ethyl 4-[[2-(furan-3-ylmethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2ccccc2NCc2ccoc2)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-2-27-20(25)24-10-7-16(8-11-24)22-19(28)23-18-6-4-3-5-17(18)21-13-15-9-12-26-14-15/h3-6,9,12,14,16,21H,2,7-8,10-11,13H2,1H3,(H2,22,23,28) |
| InChIKey | LBUSMZUHVCOKHA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|