C23H27F3N4O2S — CID 23345169
ethyl 4-[[2-(benzylamino)-5-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate (PubChem CID 23345169) has the molecular formula C23H27F3N4O2S and a molecular weight of 480.56 g/mol. Its IUPAC name is ethyl 4-[[2-(benzylamino)-5-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(benzylamino)-5-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23345169 |
| Molecular Formula | C23H27F3N4O2S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | ethyl 4-[[2-(benzylamino)-5-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2cc(C(F)(F)F)ccc2NCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27F3N4O2S/c1-2-32-22(31)30-12-10-18(11-13-30)28-21(33)29-20-14-17(23(24,25)26)8-9-19(20)27-15-16-6-4-3-5-7-16/h3-9,14,18,27H,2,10-13,15H2,1H3,(H2,28,29,33) |
| InChIKey | YKHZYTHOHUZNQV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|