C20H26ClN3O4 — CID 167767569
N'-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-N-(3-methoxycyclobutyl)oxamide (PubChem CID 167767569) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is N'-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-N-(3-methoxycyclobutyl)oxamide.
| Compound Name | N'-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-N-(3-methoxycyclobutyl)oxamide |
|---|---|
| PubChem CID | 167767569 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N'-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-N-(3-methoxycyclobutyl)oxamide |
| SMILES | COC1CC(NC(=O)C(=O)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)C1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-28-15-9-14(10-15)24-20(27)19(26)23-13-7-8-17(21)16(11-13)18(25)22-12-5-3-2-4-6-12/h7-8,11-12,14-15H,2-6,9-10H2,1H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | XVJAWBUPLDYJAG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|