C11H13ClN3O3S- — CID 2491303
2-chloro-5-[2-(2-methoxyethylcarbamothioyl)hydrazinyl]benzoate (PubChem CID 2491303) has the molecular formula C11H13ClN3O3S- and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-chloro-5-[2-(2-methoxyethylcarbamothioyl)hydrazinyl]benzoate.
| Compound Name | 2-chloro-5-[2-(2-methoxyethylcarbamothioyl)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 2491303 |
| Molecular Formula | C11H13ClN3O3S- |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-chloro-5-[2-(2-methoxyethylcarbamothioyl)hydrazinyl]benzoate |
| SMILES | COCCNC(=S)NNc1ccc(Cl)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C11H14ClN3O3S/c1-18-5-4-13-11(19)15-14-7-2-3-9(12)8(6-7)10(16)17/h2-3,6,14H,4-5H2,1H3,(H,16,17)(H2,13,15,19)/p-1 |
| InChIKey | YSVVOFHVUXZJHQ-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|