C21H24ClN3O3S — CID 26263060
1-(4-butylphenyl)-3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonyl)amino]thiourea (PubChem CID 26263060) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonyl)amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 26263060 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonyl)amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)c2cc(Cl)c3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C21H24ClN3O3S/c1-2-3-5-14-6-8-16(9-7-14)23-21(29)25-24-20(26)15-12-17(22)19-18(13-15)27-10-4-11-28-19/h6-9,12-13H,2-5,10-11H2,1H3,(H,24,26)(H2,23,25,29) |
| InChIKey | HWQFKHNKJZYLJR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|