C17H17Cl2N3OS2 — CID 17373036
1-(2,3-dichlorophenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea (PubChem CID 17373036) has the molecular formula C17H17Cl2N3OS2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 17373036 |
| Molecular Formula | C17H17Cl2N3OS2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea |
| SMILES | Cc1ccccc1CSCC(=O)NNC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl2N3OS2/c1-11-5-2-3-6-12(11)9-25-10-15(23)21-22-17(24)20-14-8-4-7-13(18)16(14)19/h2-8H,9-10H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | ZWECAGMQVJBYCQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|