C16H23N3O2S2 — CID 2209397
1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 2209397) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 2209397 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccccc1CSCC(=O)NNC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-12-5-2-3-6-13(12)10-23-11-15(20)18-19-16(22)17-9-14-7-4-8-21-14/h2-3,5-6,14H,4,7-11H2,1H3,(H,18,20)(H2,17,19,22)/t14-/m1/s1 |
| InChIKey | ALHSRWGYMUNWBV-CQSZACIVSA-N |
| XLogP | 1.90 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|