C18H20ClN3O2S2 — CID 17373111
1-(5-chloro-2-methoxyphenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea (PubChem CID 17373111) has the molecular formula C18H20ClN3O2S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 17373111 |
| Molecular Formula | C18H20ClN3O2S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)NNC(=O)CSCc1ccccc1C |
| InChI | InChI=1S/C18H20ClN3O2S2/c1-12-5-3-4-6-13(12)10-26-11-17(23)21-22-18(25)20-15-9-14(19)7-8-16(15)24-2/h3-9H,10-11H2,1-2H3,(H,21,23)(H2,20,22,25) |
| InChIKey | DCKUSXYQRZOUFL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|