C16H14BrClFNO2S — CID 46799772
2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 46799772) has the molecular formula C16H14BrClFNO2S and a molecular weight of 418.72 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46799772 |
| Molecular Formula | C16H14BrClFNO2S |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSCc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H14BrClFNO2S/c1-22-15-5-4-12(18)7-14(15)20-16(21)9-23-8-10-2-3-11(17)6-13(10)19/h2-7H,8-9H2,1H3,(H,20,21) |
| InChIKey | MFRUDDAYTLYEGC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |