C17H17BrN2O3S — CID 8969240
2-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 8969240) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8969240 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-[[2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | COc1ccc(Br)cc1CSCC(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C17H17BrN2O3S/c1-23-15-7-6-12(18)8-11(15)9-24-10-16(21)20-14-5-3-2-4-13(14)17(19)22/h2-8H,9-10H2,1H3,(H2,19,22)(H,20,21) |
| InChIKey | JCGODKBHTVTZJV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |