C17H17FN2O3S — CID 8966272
4-[[2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 8966272) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[[2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8966272 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-[[2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | COc1ccc(F)cc1CSCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-23-15-7-4-13(18)8-12(15)9-24-10-16(21)20-14-5-2-11(3-6-14)17(19)22/h2-8H,9-10H2,1H3,(H2,19,22)(H,20,21) |
| InChIKey | AQAATWUXAJZNJD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |