C16H15F2NO2S — CID 8965975
2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-(4-fluorophenyl)acetamide (PubChem CID 8965975) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 8965975 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(F)cc1CSCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15F2NO2S/c1-21-15-7-4-13(18)8-11(15)9-22-10-16(20)19-14-5-2-12(17)3-6-14/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | ULKQYKYAGVTVEU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |