C15H12BrF2NO2S — CID 55905900
N-(5-bromo-2-methoxyphenyl)-2-(3,4-difluorophenyl)sulfanylacetamide (PubChem CID 55905900) has the molecular formula C15H12BrF2NO2S and a molecular weight of 388.23 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-2-(3,4-difluorophenyl)sulfanylacetamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-2-(3,4-difluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55905900 |
| Molecular Formula | C15H12BrF2NO2S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-2-(3,4-difluorophenyl)sulfanylacetamide |
| SMILES | COc1ccc(Br)cc1NC(=O)CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12BrF2NO2S/c1-21-14-5-2-9(16)6-13(14)19-15(20)8-22-10-3-4-11(17)12(18)7-10/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | CSONWYOMBDRVRR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |