C17H16BrNO5S — CID 24991816
2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 24991816) has the molecular formula C17H16BrNO5S and a molecular weight of 426.29 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 24991816 |
| Molecular Formula | C17H16BrNO5S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)CSc2ccc(Br)cc2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C17H16BrNO5S/c1-23-14-7-12(17(21)22)13(8-15(14)24-2)19-16(20)9-25-11-5-3-10(18)4-6-11/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | OEWSIQLKRDYLCB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |