C16H12BrClN2O3S2 — CID 4513974
5-bromo-2-[[2-(4-chlorophenyl)sulfanylacetyl]carbamothioylamino]benzoic acid (PubChem CID 4513974) has the molecular formula C16H12BrClN2O3S2 and a molecular weight of 459.77 g/mol. Its IUPAC name is 5-bromo-2-[[2-(4-chlorophenyl)sulfanylacetyl]carbamothioylamino]benzoic acid.
| Compound Name | 5-bromo-2-[[2-(4-chlorophenyl)sulfanylacetyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4513974 |
| Molecular Formula | C16H12BrClN2O3S2 |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 5-bromo-2-[[2-(4-chlorophenyl)sulfanylacetyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(CSc1ccc(Cl)cc1)NC(=S)Nc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C16H12BrClN2O3S2/c17-9-1-6-13(12(7-9)15(22)23)19-16(24)20-14(21)8-25-11-4-2-10(18)3-5-11/h1-7H,8H2,(H,22,23)(H2,19,20,21,24) |
| InChIKey | PNYVSXNJRPLZDH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|