C13H10BrClN2OS — CID 1325893
N-(5-bromo-2-pyridinyl)-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 1325893) has the molecular formula C13H10BrClN2OS and a molecular weight of 357.66 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 1325893 |
| Molecular Formula | C13H10BrClN2OS |
| Molecular Weight | 357.66 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H10BrClN2OS/c14-9-1-6-12(16-7-9)17-13(18)8-19-11-4-2-10(15)3-5-11/h1-7H,8H2,(H,16,17,18) |
| InChIKey | DUTJZLXWXGOUTA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |