C19H13BrCl2N2O — CID 66848488
N-(5-bromo-2-pyridinyl)-2,2-bis(4-chlorophenyl)acetamide (PubChem CID 66848488) has the molecular formula C19H13BrCl2N2O and a molecular weight of 436.14 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2,2-bis(4-chlorophenyl)acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2,2-bis(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 66848488 |
| Molecular Formula | C19H13BrCl2N2O |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2,2-bis(4-chlorophenyl)acetamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13BrCl2N2O/c20-14-5-10-17(23-11-14)24-19(25)18(12-1-6-15(21)7-2-12)13-3-8-16(22)9-4-13/h1-11,18H,(H,23,24,25) |
| InChIKey | HZAMAZBJGAVLMX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |