C16H14ClNO3S — CID 4188338
2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-5-methylbenzoic acid (PubChem CID 4188338) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-5-methylbenzoic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 4188338 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)CSc2ccc(Cl)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H14ClNO3S/c1-10-2-7-14(13(8-10)16(20)21)18-15(19)9-22-12-5-3-11(17)4-6-12/h2-8H,9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | CABLDHMAGBIPGS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |