C17H17ClN2O2S2 — CID 23903859
2-(4-chlorophenyl)sulfanyl-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]acetamide (PubChem CID 23903859) has the molecular formula C17H17ClN2O2S2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 23903859 |
| Molecular Formula | C17H17ClN2O2S2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(C)c(O)c(NC(=S)NC(=O)CSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H17ClN2O2S2/c1-10-7-11(2)16(22)14(8-10)19-17(23)20-15(21)9-24-13-5-3-12(18)4-6-13/h3-8,22H,9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | CSWSNFNJCFVGGI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|